Products 332938-24-6
CAS 332938-24-6 is the registry number for WAY-312208-10mMinDMSO,,. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 100mg.
10-(4-hydroxyphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione (CAS 332938-24-6) is a chemical compound with the molecular formula C24H21NO3 and a molecular weight of 371.4 g/mol. IUPAC name: 10-(4-hydroxyphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione. InChIKey: YWRZMZQUHGUGGB-UHFFFAOYSA-N.
| Molecular formula | C24H21NO3 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 10-(4-hydroxyphenyl)-7,7-dimethyl-5,6,8,10-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
| InChIKey | YWRZMZQUHGUGGB-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(C3=C(N2)C4=CC=CC=C4C3=O)C5=CC=C(C=C5)O)C(=O)C1)C |
Computed by PubChem (NCBI)
Synonyms:
Oprea1_404434, Oprea1_707457