Products 2748533-42-6
CAS 2748533-42-6 appears in our catalog under these names: JWH-018 (Indole-d5) N-Pentyl-5-carboxylic Acid, JWH 018 N–pentanoic acid metabolite–d5. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 1mg, 5mg, 500μg.
5-[2,4,5,6,7-pentadeuterio-3-(naphthalene-1-carbonyl)indol-1-yl]pentanoic acid (CAS 2748533-42-6) is a chemical compound with the molecular formula C24H21NO3 and a molecular weight of 376.5 g/mol. IUPAC name: 5-[2,4,5,6,7-pentadeuterio-3-(naphthalene-1-carbonyl)indol-1-yl]pentanoic acid. InChIKey: BYIVGHIYNFQIJX-HXXXRZHPSA-N.
| Molecular formula | C24H21NO3 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | 5-[2,4,5,6,7-pentadeuterio-3-(naphthalene-1-carbonyl)indol-1-yl]pentanoic acid |
| InChIKey | BYIVGHIYNFQIJX-HXXXRZHPSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCC(=O)O)[2H])C(=O)C3=CC=CC4=CC=CC=C43)[2H])[2H] |
Computed by PubChem (NCBI)