CAS 79561-82-3 appears in our catalog under these names: Boc–p–bromo–D–Phe–OH, Boc-D-Phe(4-Br)-OH, Boc-D-Phe(4-Br)-OH, 98%, 98%, (R)-3-(4-Bromophenyl)-2-((tert-butoxycarbonyl)amino)propanoic acid, 99.92%, Boc-4-bromo-D-phenylalanine, 95%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 1kg, 25 g, 100 g.
(2R)-3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 79561-82-3) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: (2R)-3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ULNOXUAEIPUJMK-LLVKDONJSA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | (2R)-3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ULNOXUAEIPUJMK-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)