Products 132224-82-9

CAS 132224-82-9 is the registry number for Methyl 2-(4-(2-aminoethyl)phenoxy)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 2-[4-(2-aminoethyl)phenoxy]acetate;hydrochloride (CAS 132224-82-9) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: methyl 2-[4-(2-aminoethyl)phenoxy]acetate;hydrochloride. InChIKey: WVRVSXCLRWNWQK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO3
Molecular weight245.70 g/mol
IUPAC namemethyl 2-[4-(2-aminoethyl)phenoxy]acetate;hydrochloride
InChIKeyWVRVSXCLRWNWQK-UHFFFAOYSA-N
SMILESCOC(=O)COC1=CC=C(C=C1)CCN.Cl

Computed by PubChem (NCBI)