CAS 132471-91-1 is the registry number for 3'-O-NH2-2'-dG. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-9-[(2R,4S,5R)-4-aminooxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 132471-91-1) is a chemical compound with the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. IUPAC name: 2-amino-9-[(2R,4S,5R)-4-aminooxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: WIBZBEGGPAGQDH-KVQBGUIXSA-N.
| Molecular formula | C10H14N6O4 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | 2-amino-9-[(2R,4S,5R)-4-aminooxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | WIBZBEGGPAGQDH-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)CO)ON |
Computed by PubChem (NCBI)