CAS 34079-68-0 appears in our catalog under these names: 2,6-Diaminopurine arabinoside, 95%, Nelarabine Impurity 12, 2,6-Diaminopurine Arabinoside, 2,6–Diaminopurine arabinoside, 2,6-Diamino-9-(b-D-arabinofuranosyl)purine. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 250mg, on request, 500mg, 10g, 25g, 100g.
(2R,3S,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 34079-68-0) is a chemical compound with the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: ZDTFMPXQUSBYRL-FJFJXFQQSA-N.
| Molecular formula | C10H14N6O4 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | ZDTFMPXQUSBYRL-FJFJXFQQSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)N)N |
Computed by PubChem (NCBI)