CAS 4099-84-7 appears in our catalog under these names: Guanosine, 5'-amino-5'-deoxy-, 95%, 5'–Amino–5'–deoxyguanosine, 5'-Amino-5'-deoxyguanosine, 5'-Amino-5'-deoxyguanosine 95%, Guanosine, 5'-amino-5'-deoxy-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 25mg, 5mg, 50mg, 2mg, 10mg, 250mg, 1g.
2-amino-9-[(2R,3R,4S,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one (CAS 4099-84-7) is a chemical compound with the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4S,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one. InChIKey: JUWYSPSHBRXOGR-UUOKFMHZSA-N.
| Molecular formula | C10H14N6O4 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4S,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one |
| InChIKey | JUWYSPSHBRXOGR-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CN)O)O)N=C(NC2=O)N |
Computed by PubChem (NCBI)