CAS 80015-76-5 appears in our catalog under these names: 3'-Amino-3'-deoxyguanosine, 98%, 3'-Amino-3'-deoxyguanosine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 10mg, 50mg, 250mg, 100mg.
2-amino-9-[(2R,3R,4S,5S)-4-amino-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 80015-76-5) is a chemical compound with the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4S,5S)-4-amino-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: WQZYJWINGYJUHN-DXTOWSMRSA-N.
| Molecular formula | C10H14N6O4 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4S,5S)-4-amino-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | WQZYJWINGYJUHN-DXTOWSMRSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)N)O)N=C(NC2=O)N |
Computed by PubChem (NCBI)