Products 3868-33-5
CAS 3868-33-5 appears in our catalog under these names: 8-Aminoadenosine, 95%, 8-Aminoadenosine, 8-Aminoadenosine, 99.94%. Offered by: Combi-blocks, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 2mg, 50mg, 25mg, 500mg, 5 mg.
(2R,3R,4S,5R)-2-(6,8-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 3868-33-5) is a chemical compound with the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6,8-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: DVGWFQILDUEEGX-UUOKFMHZSA-N.
| Molecular formula | C10H14N6O4 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6,8-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | DVGWFQILDUEEGX-UUOKFMHZSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C(=N2)N)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)