Products 1882840-21-2
CAS 1882840-21-2 is the registry number for (Z)-3-Benzyl-2-(phenylimino)thiazolidin-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-benzyl-2-phenylimino-1,3-thiazolidin-4-one (CAS 1882840-21-2) is a chemical compound with the molecular formula C16H14N2OS and a molecular weight of 282.4 g/mol. IUPAC name: 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one. InChIKey: OOASYVSFHAGPIX-UHFFFAOYSA-N.
| Molecular formula | C16H14N2OS |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 3-benzyl-2-phenylimino-1,3-thiazolidin-4-one |
| InChIKey | OOASYVSFHAGPIX-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=NC2=CC=CC=C2)S1)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)