CAS 132622-85-6 is the registry number for (2R,4R)-1-(tert-butoxycarbonyl)-4-cyanopyrrolidine-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R,4R)-4-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 132622-85-6) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: (2R,4R)-4-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: MIVXQYMYEMUMKK-JGVFFNPUSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | (2R,4R)-4-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | MIVXQYMYEMUMKK-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@@H]1C(=O)O)C#N |
Computed by PubChem (NCBI)