CAS 132630-83-2 is the registry number for 2-(2,4,5-Trifluoro-3-methylphenyl)-4,5-dihydro-4,4-dimethyloxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,4-dimethyl-2-(2,4,5-trifluoro-3-methylphenyl)-5H-1,3-oxazole (CAS 132630-83-2) is a chemical compound with the molecular formula C12H12F3NO and a molecular weight of 243.22 g/mol. IUPAC name: 4,4-dimethyl-2-(2,4,5-trifluoro-3-methylphenyl)-5H-1,3-oxazole. InChIKey: SLWCAJZXIPUHCV-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 4,4-dimethyl-2-(2,4,5-trifluoro-3-methylphenyl)-5H-1,3-oxazole |
| InChIKey | SLWCAJZXIPUHCV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1F)F)C2=NC(CO2)(C)C)F |
Computed by PubChem (NCBI)