Products 1981320-69-7
CAS 1981320-69-7 is the registry number for 1-[1-(2,2,2-Trifluoro-ethyl)-2,3-dihydro-1h-indol-5-yl]-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[1-(2,2,2-trifluoroethyl)-2,3-dihydroindol-5-yl]ethanone (CAS 1981320-69-7) is a chemical compound with the molecular formula C12H12F3NO and a molecular weight of 243.22 g/mol. IUPAC name: 1-[1-(2,2,2-trifluoroethyl)-2,3-dihydroindol-5-yl]ethanone. InChIKey: CROHBDQVRSUEQF-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 1-[1-(2,2,2-trifluoroethyl)-2,3-dihydroindol-5-yl]ethanone |
| InChIKey | CROHBDQVRSUEQF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)N(CC2)CC(F)(F)F |
Computed by PubChem (NCBI)