Products 263382-53-2
CAS 263382-53-2 appears in our catalog under these names: 4,4-Dimethyl-2-(2-(trifluoromethyl) phenyl)-4,5-dihydrooxazole, 95%, 4,4-Dimethyl-2-(2-(trifluoromethyl)phenyl)-4,5-dihydrooxazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4,4-dimethyl-2-[2-(trifluoromethyl)phenyl]-5H-1,3-oxazole (CAS 263382-53-2) is a chemical compound with the molecular formula C12H12F3NO and a molecular weight of 243.22 g/mol. IUPAC name: 4,4-dimethyl-2-[2-(trifluoromethyl)phenyl]-5H-1,3-oxazole. InChIKey: HWQOBOHXBPWAAV-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 4,4-dimethyl-2-[2-(trifluoromethyl)phenyl]-5H-1,3-oxazole |
| InChIKey | HWQOBOHXBPWAAV-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=CC=CC=C2C(F)(F)F)C |
Computed by PubChem (NCBI)