CAS 87922-74-5 appears in our catalog under these names: 5–(4–(Trifluoromethyl)phenyl)–2–piperidone, 5-[4-(Trifluoromethyl)phenyl]-2-piperidone, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg.
5-[4-(trifluoromethyl)phenyl]piperidin-2-one (CAS 87922-74-5) is a chemical compound with the molecular formula C12H12F3NO and a molecular weight of 243.22 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]piperidin-2-one. InChIKey: LGEVYJYGEQLUMF-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 5-[4-(trifluoromethyl)phenyl]piperidin-2-one |
| InChIKey | LGEVYJYGEQLUMF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NCC1C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)