CAS 1707604-70-3 is the registry number for 4-(3,3-Difluoropiperidin-1-yl)-3-fluorobenzaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzaldehyde (CAS 1707604-70-3) is a chemical compound with the molecular formula C12H12F3NO and a molecular weight of 243.22 g/mol. IUPAC name: 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzaldehyde. InChIKey: QOAXXDHFZQOWAL-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 4-(3,3-difluoropiperidin-1-yl)-3-fluorobenzaldehyde |
| InChIKey | QOAXXDHFZQOWAL-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=C(C=C(C=C2)C=O)F)(F)F |
Computed by PubChem (NCBI)