CAS 1326814-81-6 appears in our catalog under these names: 5-(1-Methyl-1h-pyrrol-2-yl)-1,2-oxazole-3-carboxylic acid, 95%, 5–(1–Methyl–2–pyrrolyl)isoxazole–3–carboxylic Acid, 5-(1-Methyl-1h-pyrrol-2-yl)-1,2-oxazole-3-carboxylic acid, >97%, >97%, 5-(1-METHYL-2-PYRROLYL)ISOXAZOLE-3-CARBOXYLIC ACID, >97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
5-(1-methylpyrrol-2-yl)-1,2-oxazole-3-carboxylic acid (CAS 1326814-81-6) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 5-(1-methylpyrrol-2-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: BRRLYKWPVBTLOR-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 5-(1-methylpyrrol-2-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | BRRLYKWPVBTLOR-UHFFFAOYSA-N |
| SMILES | CN1C=CC=C1C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)