Products 1327173-91-0
CAS 1327173-91-0 is the registry number for (1R,2S)-m-nitro-erythro-Chloramphenicol. Offered by: TRC. Available pack sizes: 50mg.
2,2-dichloro-N-[(1S,2R)-1,3-dihydroxy-1-(3-nitrophenyl)propan-2-yl]acetamide (CAS 1327173-91-0) is a chemical compound with the molecular formula C11H12Cl2N2O5 and a molecular weight of 323.13 g/mol. IUPAC name: 2,2-dichloro-N-[(1S,2R)-1,3-dihydroxy-1-(3-nitrophenyl)propan-2-yl]acetamide. InChIKey: FTMJFHVKAXPFIY-BDAKNGLRSA-N.
| Molecular formula | C11H12Cl2N2O5 |
|---|---|
| Molecular weight | 323.13 g/mol |
| IUPAC name | 2,2-dichloro-N-[(1S,2R)-1,3-dihydroxy-1-(3-nitrophenyl)propan-2-yl]acetamide |
| InChIKey | FTMJFHVKAXPFIY-BDAKNGLRSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])[C@@H]([C@@H](CO)NC(=O)C(Cl)Cl)O |
Computed by PubChem (NCBI)