Products 132796-52-2

CAS 132796-52-2 is the registry number for Emodin-d4. Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 1 mg, 10 mg.

Structural formula: {0} (CAS {1})

1-deuterio-4,5,7-trihydroxy-2-(trideuteriomethyl)anthracene-9,10-dione (CAS 132796-52-2) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 274.26 g/mol. IUPAC name: 1-deuterio-4,5,7-trihydroxy-2-(trideuteriomethyl)anthracene-9,10-dione. InChIKey: RHMXXJGYXNZAPX-MZCSYVLQSA-N.

Identity
Molecular formulaC15H10O5
Molecular weight274.26 g/mol
IUPAC name1-deuterio-4,5,7-trihydroxy-2-(trideuteriomethyl)anthracene-9,10-dione
InChIKeyRHMXXJGYXNZAPX-MZCSYVLQSA-N
SMILES[2H]C1=C(C=C(C2=C1C(=O)C3=C(C2=O)C(=CC(=C3)O)O)O)C([2H])([2H])[2H]

Computed by PubChem (NCBI)