CAS 13296-94-1 appears in our catalog under these names: 2-Bromo-4-nitroaniline, 2–Bromo–4–nitroaniline, 2-Bromo-4-nitroaniline, >98.0%(GC), 2-Bromo-4-nitroaniline 97%, 2-Bromo-4-nitroaniline, 97%, 97%. Offered by: TRC, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 10g, 1g, 50g, 100g, 25g, 500g, 5g, 250g.
2-bromo-4-nitroaniline (CAS 13296-94-1) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 2-bromo-4-nitroaniline. InChIKey: CGPPWNTVTNCHDO-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2-bromo-4-nitroaniline |
| InChIKey | CGPPWNTVTNCHDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Br)N |
Computed by PubChem (NCBI)