CAS 132961-65-0 is the registry number for Rel-(1R,3R)-3-hydroxycyclohexyl 4-methylbenzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,3R)-3-hydroxycyclohexyl] 4-methylbenzenesulfonate (CAS 132961-65-0) is a chemical compound with the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. IUPAC name: [(1R,3R)-3-hydroxycyclohexyl] 4-methylbenzenesulfonate. InChIKey: MCCCNWCLNROYIN-VXGBXAGGSA-N.
| Molecular formula | C13H18O4S |
|---|---|
| Molecular weight | 270.35 g/mol |
| IUPAC name | [(1R,3R)-3-hydroxycyclohexyl] 4-methylbenzenesulfonate |
| InChIKey | MCCCNWCLNROYIN-VXGBXAGGSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@@H]2CCC[C@H](C2)O |
Computed by PubChem (NCBI)