CAS 76911-01-8 appears in our catalog under these names: Hex-5-yn-1-yl 4-methylbenzenesulfonate, 98%, Hex-5-yn-1-yl 4-methylbenzenesulfonate, 98%, 98%, Hex-5-yn-1-yl 4-methylbenzenesulfonate, 98.0%. Offered by: AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 250 mg, 100 mg, 1 g, 500 mg.
Hex-5-yn-1-ol;4-methylbenzenesulfonic acid (CAS 76911-01-8) is a chemical compound with the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. IUPAC name: hex-5-yn-1-ol;4-methylbenzenesulfonic acid. InChIKey: AJICHWTVWROOGW-UHFFFAOYSA-N.
| Molecular formula | C13H18O4S |
|---|---|
| Molecular weight | 270.35 g/mol |
| IUPAC name | hex-5-yn-1-ol;4-methylbenzenesulfonic acid |
| InChIKey | AJICHWTVWROOGW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C#CCCCCO |
Computed by PubChem (NCBI)