Products 1430820-46-4
CAS 1430820-46-4 appears in our catalog under these names: 2,2,4,6,7-pentamethyl-2,3-dihydrobenzofuran-5-sulfonic acid, 2,2,4,6,7-Pentamethyl-2,3-dihydrobenzofuran-5-sulfonic acid 97%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 1g.
2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonic acid (CAS 1430820-46-4) is a chemical compound with the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. IUPAC name: 2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonic acid. InChIKey: DJXPWYXYLJCSQV-UHFFFAOYSA-N.
| Molecular formula | C13H18O4S |
|---|---|
| Molecular weight | 270.35 g/mol |
| IUPAC name | 2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonic acid |
| InChIKey | DJXPWYXYLJCSQV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)O)C |
Computed by PubChem (NCBI)