Products 132961-66-1

CAS 132961-66-1 is the registry number for Rel-(1R,3S)-3-hydroxycyclohexyl 4-methylbenzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(1R,3S)-3-hydroxycyclohexyl] 4-methylbenzenesulfonate (CAS 132961-66-1) is a chemical compound with the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. IUPAC name: [(1R,3S)-3-hydroxycyclohexyl] 4-methylbenzenesulfonate. InChIKey: MCCCNWCLNROYIN-NWDGAFQWSA-N.

Identity
Molecular formulaC13H18O4S
Molecular weight270.35 g/mol
IUPAC name[(1R,3S)-3-hydroxycyclohexyl] 4-methylbenzenesulfonate
InChIKeyMCCCNWCLNROYIN-NWDGAFQWSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O[C@@H]2CCC[C@@H](C2)O

Computed by PubChem (NCBI)