CAS 92121-36-3 is the registry number for 4-Hydroxycyclohexyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-hydroxycyclohexyl) 4-methylbenzenesulfonate (CAS 92121-36-3) is a chemical compound with the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. IUPAC name: (4-hydroxycyclohexyl) 4-methylbenzenesulfonate. InChIKey: KCDKSZWKVROYKI-UHFFFAOYSA-N.
| Molecular formula | C13H18O4S |
|---|---|
| Molecular weight | 270.35 g/mol |
| IUPAC name | (4-hydroxycyclohexyl) 4-methylbenzenesulfonate |
| InChIKey | KCDKSZWKVROYKI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CCC(CC2)O |
Computed by PubChem (NCBI)