CAS 1329792-51-9 appears in our catalog under these names: 4-Aminophenazone-d3, >95% (HPLC), Ampyrone-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
4-amino-5-methyl-2-phenyl-1-(trideuteriomethyl)pyrazol-3-one (CAS 1329792-51-9) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 206.26 g/mol. IUPAC name: 4-amino-5-methyl-2-phenyl-1-(trideuteriomethyl)pyrazol-3-one. InChIKey: RLFWWDJHLFCNIJ-BMSJAHLVSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | 4-amino-5-methyl-2-phenyl-1-(trideuteriomethyl)pyrazol-3-one |
| InChIKey | RLFWWDJHLFCNIJ-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=C(C(=O)N1C2=CC=CC=C2)N)C |
Computed by PubChem (NCBI)