CAS 1329796-53-3 appears in our catalog under these names: Entecavir-13C2,15N, >95% (HPLC), Entecavir-13C2,15N, Entecavir-13C2,15N-1. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, Get quote.
2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one (CAS 1329796-53-3) is a chemical compound with the molecular formula C12H15N5O3 and a molecular weight of 280.26 g/mol. IUPAC name: 2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one. InChIKey: QDGZDCVAUDNJFG-MTGFINLASA-N.
| Molecular formula | C12H15N5O3 |
|---|---|
| Molecular weight | 280.26 g/mol |
| IUPAC name | 2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one |
| InChIKey | QDGZDCVAUDNJFG-MTGFINLASA-N |
| SMILES | C=C1[C@H](C[C@@H]([C@H]1CO)O)N2C=[15N]C3=[13C]2N=C(N[13C]3=O)N |
Computed by PubChem (NCBI)