CAS 69565-92-0 is the registry number for Rel-2-amino-5-((((1R,4R,5S)-4,5-dihydroxycyclopent-2-en-1-yl)amino)methyl)-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Queuine is a pyrrolopyrimidine. It has a role as an Escherichia coli metabolite. It is a conjugate base of a queuine(1+).
Source: ChEBI
| Molecular formula | C12H15N5O3 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 2-amino-5-[[[(1S,4S,5R)-4,5-dihydroxycyclopent-2-en-1-yl]amino]methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| InChIKey | WYROLENTHWJFLR-ACLDMZEESA-N |
| SMILES | C1=C[C@@H]([C@@H]([C@H]1NCC2=CNC3=C2C(=O)NC(=N3)N)O)O |
Computed by PubChem (NCBI)