Products 188399-46-4
CAS 188399-46-4 appears in our catalog under these names: ent-Entecavir, ent-Entecavir, >95% (HPLC), (1R,3S,4R)-ent-Entecavir, Entecavir Impurity 4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 10 mg, 1 mg.
2-amino-9-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one (CAS 188399-46-4) is a chemical compound with the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. IUPAC name: 2-amino-9-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one. InChIKey: QDGZDCVAUDNJFG-BWZBUEFSSA-N.
| Molecular formula | C12H15N5O3 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 2-amino-9-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one |
| InChIKey | QDGZDCVAUDNJFG-BWZBUEFSSA-N |
| SMILES | C=C1[C@@H](C[C@H]([C@@H]1CO)O)N2C=NC3=C2N=C(NC3=O)N |
Computed by PubChem (NCBI)