Products 1367369-76-3
CAS 1367369-76-3 appears in our catalog under these names: 2-Amino-9-((1R,3R,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl)-1H-purin-6(9H)-one, 95+%, Entecavir Impurity 1, (1R,3R,4R)-Entecavir, >95% (HPLC), Entecavir Impurity 2. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2,5mg.
2-amino-9-[(1R,3R,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one (CAS 1367369-76-3) is a chemical compound with the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. IUPAC name: 2-amino-9-[(1R,3R,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one. InChIKey: QDGZDCVAUDNJFG-XLPZGREQSA-N.
| Molecular formula | C12H15N5O3 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 2-amino-9-[(1R,3R,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one |
| InChIKey | QDGZDCVAUDNJFG-XLPZGREQSA-N |
| SMILES | C=C1[C@@H](C[C@H]([C@H]1CO)O)N2C=NC3=C2N=C(NC3=O)N |
Computed by PubChem (NCBI)