Products 1367369-79-6
CAS 1367369-79-6 appears in our catalog under these names: (1S,3S,4R)-Entecavir, (1S, 3S, 4R)-Entecavir, Entecavir Impurity 2. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
2-amino-9-[(1S,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one (CAS 1367369-79-6) is a chemical compound with the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. IUPAC name: 2-amino-9-[(1S,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one. InChIKey: QDGZDCVAUDNJFG-GJMOJQLCSA-N.
| Molecular formula | C12H15N5O3 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 2-amino-9-[(1S,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one |
| InChIKey | QDGZDCVAUDNJFG-GJMOJQLCSA-N |
| SMILES | C=C1[C@H](C[C@H]([C@@H]1CO)O)N2C=NC3=C2N=C(NC3=O)N |
Computed by PubChem (NCBI)
Synonyms:
(1S,3S,4R)-Entecavir, (1S, 3S, 4R)-Entecavir