Products 1329835-46-2
CAS 1329835-46-2 is the registry number for 2-Methyl-3-phenylbenzoic Acid-d5 Methyl Ester. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Methyl 2,3,4-trideuterio-5-(2,3-dideuteriophenyl)-6-methylbenzoate (CAS 1329835-46-2) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 231.30 g/mol. IUPAC name: methyl 2,3,4-trideuterio-5-(2,3-dideuteriophenyl)-6-methylbenzoate. InChIKey: HSBPPUMWUBCKIJ-UKLAVMBXSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 231.30 g/mol |
| IUPAC name | methyl 2,3,4-trideuterio-5-(2,3-dideuteriophenyl)-6-methylbenzoate |
| InChIKey | HSBPPUMWUBCKIJ-UKLAVMBXSA-N |
| SMILES | [2H]C1=CC=CC(=C1[2H])C2=C(C(=C(C(=C2[2H])[2H])[2H])C(=O)OC)C |
Computed by PubChem (NCBI)