CAS 1329835-48-4 is the registry number for (4-Chloro-2-methylphenoxy)acetic Acid-13C6. Offered by: TRC. Available pack sizes: 10mg.
2-(4-chloro-2-methyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid (CAS 1329835-48-4) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 206.57 g/mol. IUPAC name: 2-(4-chloro-2-methyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid. InChIKey: WHKUVVPPKQRRBV-BOCFXHSMSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2-(4-chloro-2-methyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid |
| InChIKey | WHKUVVPPKQRRBV-BOCFXHSMSA-N |
| SMILES | C[13C]1=[13C]([13CH]=[13CH][13C](=[13CH]1)Cl)OCC(=O)O |
Computed by PubChem (NCBI)