Products 2469242-78-0
CAS 2469242-78-0 is the registry number for MCPA-d3-1. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-(4-chloro-2,3,5-trideuterio-6-methylphenoxy)acetic acid (CAS 2469242-78-0) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 203.64 g/mol. IUPAC name: 2-(4-chloro-2,3,5-trideuterio-6-methylphenoxy)acetic acid. InChIKey: WHKUVVPPKQRRBV-NRUYWUNFSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | 2-(4-chloro-2,3,5-trideuterio-6-methylphenoxy)acetic acid |
| InChIKey | WHKUVVPPKQRRBV-NRUYWUNFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OCC(=O)O)C)[2H])Cl)[2H] |
Computed by PubChem (NCBI)
Synonyms:
MCPA D3 (phenyl D3), MCPA-d3, 2-(4-chloro-2,3,5-trideuterio-6-methylphenoxy)acetic acid, (4-Chloro-2-methylphenoxy-d3)acetic acid, (4-?Chloro-?2-?methylphenoxy-?2,?3,?5-?d3)?acetic Acid, MCPA D3 (phenyl D3) 100 microg/mL in Acetone, orb2299548, MCPA D3 (phenyl D3) 100 |Ig/mL in Acetone, (4-Chloro-2-methylphenoxy-2,?3,?5-d3)?acetic Acid