CAS 1329836-02-3 is the registry number for Dansyl Acid-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 50 mg, 25 mg, 100 mg.
5-[bis(trideuteriomethyl)amino]naphthalene-1-sulfonic acid (CAS 1329836-02-3) is a chemical compound with the molecular formula C12H13NO3S and a molecular weight of 257.34 g/mol. IUPAC name: 5-[bis(trideuteriomethyl)amino]naphthalene-1-sulfonic acid. InChIKey: BBEQQKBWUHCIOU-WFGJKAKNSA-N.
| Molecular formula | C12H13NO3S |
|---|---|
| Molecular weight | 257.34 g/mol |
| IUPAC name | 5-[bis(trideuteriomethyl)amino]naphthalene-1-sulfonic acid |
| InChIKey | BBEQQKBWUHCIOU-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C1=CC=CC2=C1C=CC=C2S(=O)(=O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)