Products 1329836-02-3

CAS 1329836-02-3 is the registry number for Dansyl Acid-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 50 mg, 25 mg, 100 mg.

Structural formula: {0} (CAS {1})

5-[bis(trideuteriomethyl)amino]naphthalene-1-sulfonic acid (CAS 1329836-02-3) is a chemical compound with the molecular formula C12H13NO3S and a molecular weight of 257.34 g/mol. IUPAC name: 5-[bis(trideuteriomethyl)amino]naphthalene-1-sulfonic acid. InChIKey: BBEQQKBWUHCIOU-WFGJKAKNSA-N.

Identity
Molecular formulaC12H13NO3S
Molecular weight257.34 g/mol
IUPAC name5-[bis(trideuteriomethyl)amino]naphthalene-1-sulfonic acid
InChIKeyBBEQQKBWUHCIOU-WFGJKAKNSA-N
SMILES[2H]C([2H])([2H])N(C1=CC=CC2=C1C=CC=C2S(=O)(=O)O)C([2H])([2H])[2H]

Computed by PubChem (NCBI)