CAS 1329838-21-2 is the registry number for 4-((3-Hydroxymethylphenyl)amino)-3-pyridine-sulfonamide. Offered by: TRC. Available pack sizes: 250mg, 25mg.
4-[3-(hydroxymethyl)anilino]pyridine-3-sulfonamide (CAS 1329838-21-2) is a chemical compound with the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. IUPAC name: 4-[3-(hydroxymethyl)anilino]pyridine-3-sulfonamide. InChIKey: KOZLTKIXPIBELL-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O3S |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | 4-[3-(hydroxymethyl)anilino]pyridine-3-sulfonamide |
| InChIKey | KOZLTKIXPIBELL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC2=C(C=NC=C2)S(=O)(=O)N)CO |
Computed by PubChem (NCBI)