Products 740746-58-1
CAS 740746-58-1 is the registry number for Torasemide Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.
1-hydroxy-4-(3-methylphenyl)iminopyridine-3-sulfonamide (CAS 740746-58-1) is a chemical compound with the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. IUPAC name: 1-hydroxy-4-(3-methylphenyl)iminopyridine-3-sulfonamide. InChIKey: ACHHCAGGNAKEDI-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O3S |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | 1-hydroxy-4-(3-methylphenyl)iminopyridine-3-sulfonamide |
| InChIKey | ACHHCAGGNAKEDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N=C2C=CN(C=C2S(=O)(=O)N)O |
Computed by PubChem (NCBI)