CAS 1340757-30-3 is the registry number for 2-[(3-Methoxyphenyl)amino]pyridine-3-sulfonamide, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3-methoxyanilino)pyridine-3-sulfonamide (CAS 1340757-30-3) is a chemical compound with the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. IUPAC name: 2-(3-methoxyanilino)pyridine-3-sulfonamide. InChIKey: PSAZZKWBVRCYGT-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O3S |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | 2-(3-methoxyanilino)pyridine-3-sulfonamide |
| InChIKey | PSAZZKWBVRCYGT-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NC2=C(C=CC=N2)S(=O)(=O)N |
Computed by PubChem (NCBI)