CAS 59729-37-2 appears in our catalog under these names: Fexinidazole, Fexinidazole/ 99.79% (existing batch purity), Fexinidazole (HOE 239), 1-Methyl-2-((4-(methylthio)phenoxy)methyl)-5-nitro-1H-imidazole, Fexinidazole, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 25mg, 5mg, 10mg, 50mg, 100mg, 200mg, 500mg, 10mM (in 1ml dmso).
1-methyl-2-[(4-methylsulfanylphenoxy)methyl]-5-nitroimidazole (CAS 59729-37-2) is a chemical compound with the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. IUPAC name: 1-methyl-2-[(4-methylsulfanylphenoxy)methyl]-5-nitroimidazole. InChIKey: MIWWSGDADVMLTG-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O3S |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | 1-methyl-2-[(4-methylsulfanylphenoxy)methyl]-5-nitroimidazole |
| InChIKey | MIWWSGDADVMLTG-UHFFFAOYSA-N |
| SMILES | CN1C(=CN=C1COC2=CC=C(C=C2)SC)[N+](=O)[O-] |
Computed by PubChem (NCBI)