Products 571917-26-5
CAS 571917-26-5 appears in our catalog under these names: N-(2-Methoxyethyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine, 95%, N-(2-Methoxyethyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N-(2-methoxyethyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine (CAS 571917-26-5) is a chemical compound with the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. IUPAC name: N-(2-methoxyethyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine. InChIKey: NNLDFACMLCQNLI-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O3S |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | N-(2-methoxyethyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
| InChIKey | NNLDFACMLCQNLI-UHFFFAOYSA-N |
| SMILES | COCCNC1=NC(=CS1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)