Products 133001-95-3
CAS 133001-95-3 is the registry number for 6-Bromo-2,2-dimethyl-3,4-dihydro-2H-1,3-benzoxazin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-2,2-dimethyl-3H-1,3-benzoxazin-4-one (CAS 133001-95-3) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-3H-1,3-benzoxazin-4-one. InChIKey: ZGQFBHVWBMPUBH-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-3H-1,3-benzoxazin-4-one |
| InChIKey | ZGQFBHVWBMPUBH-UHFFFAOYSA-N |
| SMILES | CC1(NC(=O)C2=C(O1)C=CC(=C2)Br)C |
Computed by PubChem (NCBI)