CAS 1330265-04-7 appears in our catalog under these names: Hypoxanthine-13C2,15N, >95% (HPLC), Hypoxanthine–13C2,15N, Hypoxanthine-13C2,15N, Hypoxanthine-¹³C2,¹⁵N, ≥95 atom%,≥90%, ≥95 atom%,≥90%, Hypoxanthine-13C2,15N, 91.0%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,5mg, 1 mg.
1,7-dihydropurin-6-one (CAS 1330265-04-7) is a chemical compound with the molecular formula C5H4N4O and a molecular weight of 139.09 g/mol. IUPAC name: 1,7-dihydropurin-6-one. InChIKey: FDGQSTZJBFJUBT-JYLXJXPXSA-N.
| Molecular formula | C5H4N4O |
|---|---|
| Molecular weight | 139.09 g/mol |
| IUPAC name | 1,7-dihydropurin-6-one |
| InChIKey | FDGQSTZJBFJUBT-JYLXJXPXSA-N |
| SMILES | C1=N[13C]2=[13C](C(=O)N1)[15NH]C=N2 |
Computed by PubChem (NCBI)