CAS 2483831-32-7 appears in our catalog under these names: Hypoxanthine-d4, >95% (HPLC), Hypoxanthine-d4, 99 atom % D, min 98% Chemical Purity, Hypoxanthine–d4, Hypoxanthine-d4, 99.70%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 0,1g, 0,05g, 50mg, 10 mg.
2,3,7,8-tetradeuteriopurin-6-one (CAS 2483831-32-7) is a chemical compound with the molecular formula C5H4N4O and a molecular weight of 140.14 g/mol. IUPAC name: 2,3,7,8-tetradeuteriopurin-6-one. InChIKey: FDGQSTZJBFJUBT-OPTZXGQFSA-N.
| Molecular formula | C5H4N4O |
|---|---|
| Molecular weight | 140.14 g/mol |
| IUPAC name | 2,3,7,8-tetradeuteriopurin-6-one |
| InChIKey | FDGQSTZJBFJUBT-OPTZXGQFSA-N |
| SMILES | [2H]C1=NC2=C(N1[2H])C(=O)N=C(N2[2H])[2H] |
Computed by PubChem (NCBI)