Products 244769-71-9
CAS 244769-71-9 is the registry number for Hypoxanthine-13C,15N2. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
1,7-dihydropurin-6-one (CAS 244769-71-9) is a chemical compound with the molecular formula C5H4N4O and a molecular weight of 139.09 g/mol. IUPAC name: 1,7-dihydropurin-6-one. InChIKey: FDGQSTZJBFJUBT-ZFKSAQBOSA-N.
| Molecular formula | C5H4N4O |
|---|---|
| Molecular weight | 139.09 g/mol |
| IUPAC name | 1,7-dihydropurin-6-one |
| InChIKey | FDGQSTZJBFJUBT-ZFKSAQBOSA-N |
| SMILES | C1=NC2=C(N1)C(=O)[15NH][13CH]=[15N]2 |
Computed by PubChem (NCBI)