Products 697807-02-6
CAS 697807-02-6 appears in our catalog under these names: Hypoxanthine–d2, Hypoxanthine-d2, 98.00%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 10 mg, 5 mg.
2,8-dideuterio-3,7-dihydropurin-6-one (CAS 697807-02-6) is a chemical compound with the molecular formula C5H4N4O and a molecular weight of 138.12 g/mol. IUPAC name: 2,8-dideuterio-3,7-dihydropurin-6-one. InChIKey: FDGQSTZJBFJUBT-QDNHWIQGSA-N.
| Molecular formula | C5H4N4O |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 2,8-dideuterio-3,7-dihydropurin-6-one |
| InChIKey | FDGQSTZJBFJUBT-QDNHWIQGSA-N |
| SMILES | [2H]C1=NC2=C(N1)C(=O)N=C(N2)[2H] |
Computed by PubChem (NCBI)