Products 77910-30-6
CAS 77910-30-6 appears in our catalog under these names: Hypoxanthine–15N4, Hypoxanthine-15N4, 98.50%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
1,7-dihydropurin-6-one (CAS 77910-30-6) is a chemical compound with the molecular formula C5H4N4O and a molecular weight of 140.08 g/mol. IUPAC name: 1,7-dihydropurin-6-one. InChIKey: FDGQSTZJBFJUBT-NNZQUYKOSA-N.
| Molecular formula | C5H4N4O |
|---|---|
| Molecular weight | 140.08 g/mol |
| IUPAC name | 1,7-dihydropurin-6-one |
| InChIKey | FDGQSTZJBFJUBT-NNZQUYKOSA-N |
| SMILES | C1=[15N]C2=C([15NH]1)C(=O)[15NH]C=[15N]2 |
Computed by PubChem (NCBI)