CAS 1330277-43-4 appears in our catalog under these names: 3-Phenoxybenzaldehyde-d5, >95% (HPLC), D5-3-Phenoxybenzaldehyde. Offered by: TRC, HPC Standards. Available pack sizes: 50mg, 5mg, 1x10mg.
3-(2,3,4,5,6-pentadeuteriophenoxy)benzaldehyde (CAS 1330277-43-4) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 203.25 g/mol. IUPAC name: 3-(2,3,4,5,6-pentadeuteriophenoxy)benzaldehyde. InChIKey: MRLGCTNJRREZHZ-FSTBWYLISA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 203.25 g/mol |
| IUPAC name | 3-(2,3,4,5,6-pentadeuteriophenoxy)benzaldehyde |
| InChIKey | MRLGCTNJRREZHZ-FSTBWYLISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OC2=CC=CC(=C2)C=O)[2H])[2H] |
Computed by PubChem (NCBI)