CAS 13315-71-4 is the registry number for 2,4-Dimethyl alpha-Carboline. Offered by: TRC. Available pack sizes: 1g, 250mg.
2,4-dimethyl-9H-pyrido[2,3-b]indole (CAS 13315-71-4) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: 2,4-dimethyl-9H-pyrido[2,3-b]indole. InChIKey: BZDDKRSSKMTRDZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 2,4-dimethyl-9H-pyrido[2,3-b]indole |
| InChIKey | BZDDKRSSKMTRDZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C3=CC=CC=C3N2)C |
Computed by PubChem (NCBI)