Products 1331655-92-5
CAS 1331655-92-5 is the registry number for Caffeic Acid Benzyl Ester-d5. Offered by: TRC. Available pack sizes: 25mg.
(2,3,4,5,6-pentadeuteriophenyl)methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate (CAS 1331655-92-5) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 275.31 g/mol. IUPAC name: (2,3,4,5,6-pentadeuteriophenyl)methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate. InChIKey: WWVKQTNONPWVEL-RALIUCGRSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 275.31 g/mol |
| IUPAC name | (2,3,4,5,6-pentadeuteriophenyl)methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| InChIKey | WWVKQTNONPWVEL-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])COC(=O)C=CC2=CC(=C(C=C2)O)O)[2H])[2H] |
Computed by PubChem (NCBI)