CAS 133223-48-0 is the registry number for Methyl 4-hydroxythieno[2,3-b]pyridine-6-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate (CAS 133223-48-0) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate. InChIKey: VRJSDVWMQMEGQU-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | methyl 4-oxo-7H-thieno[2,3-b]pyridine-6-carboxylate |
| InChIKey | VRJSDVWMQMEGQU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)SC=C2 |
Computed by PubChem (NCBI)